C15H21NS — CID 112717069
3-(2,5-diethylphenyl)butyl thiocyanate (PubChem CID 112717069) has the molecular formula C15H21NS and a molecular weight of 247.41 g/mol. Its IUPAC name is 3-(2,5-diethylphenyl)butyl thiocyanate.
| Compound Name | 3-(2,5-diethylphenyl)butyl thiocyanate |
|---|---|
| PubChem CID | 112717069 |
| Molecular Formula | C15H21NS |
| Molecular Weight | 247.41 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 3-(2,5-diethylphenyl)butyl thiocyanate |
| SMILES | CCc1ccc(CC)c(C(C)CCSC#N)c1 |
| InChI | InChI=1S/C15H21NS/c1-4-13-6-7-14(5-2)15(10-13)12(3)8-9-17-11-16/h6-7,10,12H,4-5,8-9H2,1-3H3 |
| InChIKey | BQBXYAMQTVVFGK-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.41 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|