C11H11Cl2NS — CID 112717515
3-(2,3-dichlorophenyl)butyl thiocyanate (PubChem CID 112717515) has the molecular formula C11H11Cl2NS and a molecular weight of 260.19 g/mol. Its IUPAC name is 3-(2,3-dichlorophenyl)butyl thiocyanate.
| Compound Name | 3-(2,3-dichlorophenyl)butyl thiocyanate |
|---|---|
| PubChem CID | 112717515 |
| Molecular Formula | C11H11Cl2NS |
| Molecular Weight | 260.19 g/mol |
| Exact Mass | 259.00 |
| IUPAC Name | 3-(2,3-dichlorophenyl)butyl thiocyanate |
| SMILES | CC(CCSC#N)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C11H11Cl2NS/c1-8(5-6-15-7-14)9-3-2-4-10(12)11(9)13/h2-4,8H,5-6H2,1H3 |
| InChIKey | AQQCOMTUCNBLBO-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.19 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|