C10H9Cl2NO — CID 66071304
2-(2,3-dichlorophenyl)-2-ethoxyacetonitrile (PubChem CID 66071304) has the molecular formula C10H9Cl2NO and a molecular weight of 230.09 g/mol. Its IUPAC name is 2-(2,3-dichlorophenyl)-2-ethoxyacetonitrile.
| Compound Name | 2-(2,3-dichlorophenyl)-2-ethoxyacetonitrile |
|---|---|
| PubChem CID | 66071304 |
| Molecular Formula | C10H9Cl2NO |
| Molecular Weight | 230.09 g/mol |
| Exact Mass | 229.01 |
| IUPAC Name | 2-(2,3-dichlorophenyl)-2-ethoxyacetonitrile |
| SMILES | CCOC(C#N)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C10H9Cl2NO/c1-2-14-9(6-13)7-4-3-5-8(11)10(7)12/h3-5,9H,2H2,1H3 |
| InChIKey | ACQWAZXAOIIGGS-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.09 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |