C12H16Cl2O2 — CID 83924753
5-(2,3-dichlorophenyl)hexane-2,3-diol (PubChem CID 83924753) has the molecular formula C12H16Cl2O2 and a molecular weight of 263.16 g/mol. Its IUPAC name is 5-(2,3-dichlorophenyl)hexane-2,3-diol.
| Compound Name | 5-(2,3-dichlorophenyl)hexane-2,3-diol |
|---|---|
| PubChem CID | 83924753 |
| Molecular Formula | C12H16Cl2O2 |
| Molecular Weight | 263.16 g/mol |
| Exact Mass | 262.05 |
| IUPAC Name | 5-(2,3-dichlorophenyl)hexane-2,3-diol |
| SMILES | CC(CC(O)C(C)O)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C12H16Cl2O2/c1-7(6-11(16)8(2)15)9-4-3-5-10(13)12(9)14/h3-5,7-8,11,15-16H,6H2,1-2H3 |
| InChIKey | MCSHOEHCUVBYCV-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.16 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |