C19H24Cl4O4 — CID 158468254
(1R,2R)-1-(2,3-dichlorophenyl)propane-1,2-diol;(1S,2S)-1-(2,3-dichlorophenyl)propane-1,2-diol;methane (PubChem CID 158468254) has the molecular formula C19H24Cl4O4 and a molecular weight of 458.21 g/mol. Its IUPAC name is (1R,2R)-1-(2,3-dichlorophenyl)propane-1,2-diol;(1S,2S)-1-(2,3-dichlorophenyl)propane-1,2-diol;methane.
| Compound Name | (1R,2R)-1-(2,3-dichlorophenyl)propane-1,2-diol;(1S,2S)-1-(2,3-dichlorophenyl)propane-1,2-diol;methane |
|---|---|
| PubChem CID | 158468254 |
| Molecular Formula | C19H24Cl4O4 |
| Molecular Weight | 458.21 g/mol |
| Exact Mass | 456.04 |
| IUPAC Name | (1R,2R)-1-(2,3-dichlorophenyl)propane-1,2-diol;(1S,2S)-1-(2,3-dichlorophenyl)propane-1,2-diol;methane |
| SMILES | C.C[C@@H](O)[C@H](O)c1cccc(Cl)c1Cl.C[C@H](O)[C@@H](O)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/2C9H10Cl2O2.CH4/c2*1-5(12)9(13)6-3-2-4-7(10)8(6)11;/h2*2-5,9,12-13H,1H3;1H4/t2*5-,9+;/m10./s1 |
| InChIKey | HGAJYHUOHQXMTQ-FUJYDVSXSA-N |
| XLogP | 5.45 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.21 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |