C11H17ClO2 — CID 144705754
1-(2-chlorophenyl)propane-1,2-diol;ethane (PubChem CID 144705754) has the molecular formula C11H17ClO2 and a molecular weight of 216.71 g/mol. Its IUPAC name is 1-(2-chlorophenyl)propane-1,2-diol;ethane.
| Compound Name | 1-(2-chlorophenyl)propane-1,2-diol;ethane |
|---|---|
| PubChem CID | 144705754 |
| Molecular Formula | C11H17ClO2 |
| Molecular Weight | 216.71 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 1-(2-chlorophenyl)propane-1,2-diol;ethane |
| SMILES | CC.CC(O)C(O)c1ccccc1Cl |
| InChI | InChI=1S/C9H11ClO2.C2H6/c1-6(11)9(12)7-4-2-3-5-8(7)10;1-2/h2-6,9,11-12H,1H3;1-2H3 |
| InChIKey | QMGFNDGNYVXHEJ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.71 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |