C12H17ClO — CID 114980469
1-(2-chlorophenyl)-2,3-dimethylbutan-1-ol (PubChem CID 114980469) has the molecular formula C12H17ClO and a molecular weight of 212.72 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-2,3-dimethylbutan-1-ol.
| Compound Name | 1-(2-chlorophenyl)-2,3-dimethylbutan-1-ol |
|---|---|
| PubChem CID | 114980469 |
| Molecular Formula | C12H17ClO |
| Molecular Weight | 212.72 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 1-(2-chlorophenyl)-2,3-dimethylbutan-1-ol |
| SMILES | CC(C)C(C)C(O)c1ccccc1Cl |
| InChI | InChI=1S/C12H17ClO/c1-8(2)9(3)12(14)10-6-4-5-7-11(10)13/h4-9,12,14H,1-3H3 |
| InChIKey | MFWOVMGIOIXWOT-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.72 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |