C11H16ClNO — CID 103906814
(2R)-1-[1-(2-chlorophenyl)ethylamino]propan-2-ol (PubChem CID 103906814) has the molecular formula C11H16ClNO and a molecular weight of 213.71 g/mol. Its IUPAC name is (2R)-1-[1-(2-chlorophenyl)ethylamino]propan-2-ol.
| Compound Name | (2R)-1-[1-(2-chlorophenyl)ethylamino]propan-2-ol |
|---|---|
| PubChem CID | 103906814 |
| Molecular Formula | C11H16ClNO |
| Molecular Weight | 213.71 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | (2R)-1-[1-(2-chlorophenyl)ethylamino]propan-2-ol |
| SMILES | CC(NC[C@@H](C)O)c1ccccc1Cl |
| InChI | InChI=1S/C11H16ClNO/c1-8(14)7-13-9(2)10-5-3-4-6-11(10)12/h3-6,8-9,13-14H,7H2,1-2H3/t8-,9?/m1/s1 |
| InChIKey | XMKDVTOIWFRKQX-VEDVMXKPSA-N |
| XLogP | 2.37 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.71 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |