C10H12ClF2N — CID 81378188
N-[(1R)-1-(2-chlorophenyl)ethyl]-2,2-difluoroethanamine (PubChem CID 81378188) has the molecular formula C10H12ClF2N and a molecular weight of 219.66 g/mol. Its IUPAC name is N-[(1R)-1-(2-chlorophenyl)ethyl]-2,2-difluoroethanamine.
| Compound Name | N-[(1R)-1-(2-chlorophenyl)ethyl]-2,2-difluoroethanamine |
|---|---|
| PubChem CID | 81378188 |
| Molecular Formula | C10H12ClF2N |
| Molecular Weight | 219.66 g/mol |
| Exact Mass | 219.06 |
| IUPAC Name | N-[(1R)-1-(2-chlorophenyl)ethyl]-2,2-difluoroethanamine |
| SMILES | C[C@@H](NCC(F)F)c1ccccc1Cl |
| InChI | InChI=1S/C10H12ClF2N/c1-7(14-6-10(12)13)8-4-2-3-5-9(8)11/h2-5,7,10,14H,6H2,1H3/t7-/m1/s1 |
| InChIKey | BUJXTXQEIYIORD-SSDOTTSWSA-N |
| XLogP | 3.26 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.66 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |