C10H13ClF2N2 — CID 115406269
1-(2-chlorophenyl)-N-(2,2-difluoroethyl)ethane-1,2-diamine (PubChem CID 115406269) has the molecular formula C10H13ClF2N2 and a molecular weight of 234.68 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-N-(2,2-difluoroethyl)ethane-1,2-diamine.
| Compound Name | 1-(2-chlorophenyl)-N-(2,2-difluoroethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 115406269 |
| Molecular Formula | C10H13ClF2N2 |
| Molecular Weight | 234.68 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | 1-(2-chlorophenyl)-N-(2,2-difluoroethyl)ethane-1,2-diamine |
| SMILES | NCC(NCC(F)F)c1ccccc1Cl |
| InChI | InChI=1S/C10H13ClF2N2/c11-8-4-2-1-3-7(8)9(5-14)15-6-10(12)13/h1-4,9-10,15H,5-6,14H2 |
| InChIKey | AHLXBEUSNOZVEN-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.68 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |