C11H15Cl2NO — CID 93082097
(2R)-1-[[(1S)-1-(2,5-dichlorophenyl)ethyl]amino]propan-2-ol (PubChem CID 93082097) has the molecular formula C11H15Cl2NO and a molecular weight of 248.15 g/mol. Its IUPAC name is (2R)-1-[[(1S)-1-(2,5-dichlorophenyl)ethyl]amino]propan-2-ol.
| Compound Name | (2R)-1-[[(1S)-1-(2,5-dichlorophenyl)ethyl]amino]propan-2-ol |
|---|---|
| PubChem CID | 93082097 |
| Molecular Formula | C11H15Cl2NO |
| Molecular Weight | 248.15 g/mol |
| Exact Mass | 247.05 |
| IUPAC Name | (2R)-1-[[(1S)-1-(2,5-dichlorophenyl)ethyl]amino]propan-2-ol |
| SMILES | C[C@H](NC[C@@H](C)O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C11H15Cl2NO/c1-7(15)6-14-8(2)10-5-9(12)3-4-11(10)13/h3-5,7-8,14-15H,6H2,1-2H3/t7-,8+/m1/s1 |
| InChIKey | MGYGFQOASFZFCW-SFYZADRCSA-N |
| XLogP | 3.02 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.15 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |