C13H18Cl2O2 — CID 83924756
6-(2,3-dichlorophenyl)heptane-3,4-diol (PubChem CID 83924756) has the molecular formula C13H18Cl2O2 and a molecular weight of 277.19 g/mol. Its IUPAC name is 6-(2,3-dichlorophenyl)heptane-3,4-diol.
| Compound Name | 6-(2,3-dichlorophenyl)heptane-3,4-diol |
|---|---|
| PubChem CID | 83924756 |
| Molecular Formula | C13H18Cl2O2 |
| Molecular Weight | 277.19 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 6-(2,3-dichlorophenyl)heptane-3,4-diol |
| SMILES | CCC(O)C(O)CC(C)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C13H18Cl2O2/c1-3-11(16)12(17)7-8(2)9-5-4-6-10(14)13(9)15/h4-6,8,11-12,16-17H,3,7H2,1-2H3 |
| InChIKey | SGVABFRJYHIDGA-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.19 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |