About [(2,3-dichlorophenyl)-isocyanomethyl] thiocyanate
[(2,3-dichlorophenyl)-isocyanomethyl] thiocyanate (PubChem CID 155653310) has the molecular formula C9H4Cl2N2S
and a molecular weight of 243.12 g/mol. Its IUPAC name is [(2,3-dichlorophenyl)-isocyanomethyl] thiocyanate.
Molecular Properties
| Compound Name | [(2,3-dichlorophenyl)-isocyanomethyl] thiocyanate |
| PubChem CID | 155653310 |
| Molecular Formula | C9H4Cl2N2S |
| Molecular Weight | 243.12 g/mol |
| Exact Mass | 241.95 |
| IUPAC Name | [(2,3-dichlorophenyl)-isocyanomethyl] thiocyanate |
| SMILES | [C-]#[N+]C(SC#N)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C9H4Cl2N2S/c1-13-9(14-5-12)6-3-2-4-7(10)8(6)11/h2-4,9H |
| InChIKey | UPLLKVLWFRDUQK-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 28.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.12 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze [(2,3-dichlorophenyl)-isocyanomethyl] thiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2,3-dichlorophenyl)-isocyanomethyl] thiocyanate?
The IUPAC name of [(2,3-dichlorophenyl)-isocyanomethyl] thiocyanate (CID 155653310) is [(2,3-dichlorophenyl)-isocyanomethyl] thiocyanate.
What is the SMILES notation for [(2,3-dichlorophenyl)-isocyanomethyl] thiocyanate?
The canonical SMILES for [(2,3-dichlorophenyl)-isocyanomethyl] thiocyanate is [C-]#[N+]C(SC#N)c1cccc(Cl)c1Cl.
What is the InChIKey of [(2,3-dichlorophenyl)-isocyanomethyl] thiocyanate?
The InChIKey is UPLLKVLWFRDUQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H4Cl2N2S/c1-13-9(14-5-12)6-3-2-4-7(10)8(6)11/h2-4,9H.
What are the key properties of [(2,3-dichlorophenyl)-isocyanomethyl] thiocyanate?
[(2,3-dichlorophenyl)-isocyanomethyl] thiocyanate has a molecular weight of 243.12 g/mol, XLogP of 4.13, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2,3-dichlorophenyl)-isocyanomethyl] thiocyanate is sourced from PubChem (CID 155653310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).