C12H14Cl2N2O — CID 112500817
2-(2,3-dichlorophenyl)-2-(3-methoxypropylamino)acetonitrile (PubChem CID 112500817) has the molecular formula C12H14Cl2N2O and a molecular weight of 273.16 g/mol. Its IUPAC name is 2-(2,3-dichlorophenyl)-2-(3-methoxypropylamino)acetonitrile.
| Compound Name | 2-(2,3-dichlorophenyl)-2-(3-methoxypropylamino)acetonitrile |
|---|---|
| PubChem CID | 112500817 |
| Molecular Formula | C12H14Cl2N2O |
| Molecular Weight | 273.16 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | 2-(2,3-dichlorophenyl)-2-(3-methoxypropylamino)acetonitrile |
| SMILES | COCCCNC(C#N)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C12H14Cl2N2O/c1-17-7-3-6-16-11(8-15)9-4-2-5-10(13)12(9)14/h2,4-5,11,16H,3,6-7H2,1H3 |
| InChIKey | ZUSUIVKXYOOVPS-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.16 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|