C15H25NO — CID 83921003
1-amino-4-(2,5-diethylphenyl)pentan-2-ol (PubChem CID 83921003) has the molecular formula C15H25NO and a molecular weight of 235.37 g/mol. Its IUPAC name is 1-amino-4-(2,5-diethylphenyl)pentan-2-ol.
| Compound Name | 1-amino-4-(2,5-diethylphenyl)pentan-2-ol |
|---|---|
| PubChem CID | 83921003 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | 1-amino-4-(2,5-diethylphenyl)pentan-2-ol |
| SMILES | CCc1ccc(CC)c(C(C)CC(O)CN)c1 |
| InChI | InChI=1S/C15H25NO/c1-4-12-6-7-13(5-2)15(9-12)11(3)8-14(17)10-16/h6-7,9,11,14,17H,4-5,8,10,16H2,1-3H3 |
| InChIKey | QTEPWXVDWJVGSF-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |