C16H28N2O — CID 83920924
2-amino-1-(2,5-diethylphenyl)-4-(dimethylamino)butan-1-ol (PubChem CID 83920924) has the molecular formula C16H28N2O and a molecular weight of 264.41 g/mol. Its IUPAC name is 2-amino-1-(2,5-diethylphenyl)-4-(dimethylamino)butan-1-ol.
| Compound Name | 2-amino-1-(2,5-diethylphenyl)-4-(dimethylamino)butan-1-ol |
|---|---|
| PubChem CID | 83920924 |
| Molecular Formula | C16H28N2O |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.22 |
| IUPAC Name | 2-amino-1-(2,5-diethylphenyl)-4-(dimethylamino)butan-1-ol |
| SMILES | CCc1ccc(CC)c(C(O)C(N)CCN(C)C)c1 |
| InChI | InChI=1S/C16H28N2O/c1-5-12-7-8-13(6-2)14(11-12)16(19)15(17)9-10-18(3)4/h7-8,11,15-16,19H,5-6,9-10,17H2,1-4H3 |
| InChIKey | QXQVYMGZCXDGBO-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |