C15H17IOS — CID 79684303
(2,5-diethylphenyl)-(5-iodothiophen-3-yl)methanol (PubChem CID 79684303) has the molecular formula C15H17IOS and a molecular weight of 372.27 g/mol. Its IUPAC name is (2,5-diethylphenyl)-(5-iodothiophen-3-yl)methanol.
| Compound Name | (2,5-diethylphenyl)-(5-iodothiophen-3-yl)methanol |
|---|---|
| PubChem CID | 79684303 |
| Molecular Formula | C15H17IOS |
| Molecular Weight | 372.27 g/mol |
| Exact Mass | 372.00 |
| IUPAC Name | (2,5-diethylphenyl)-(5-iodothiophen-3-yl)methanol |
| SMILES | CCc1ccc(CC)c(C(O)c2csc(I)c2)c1 |
| InChI | InChI=1S/C15H17IOS/c1-3-10-5-6-11(4-2)13(7-10)15(17)12-8-14(16)18-9-12/h5-9,15,17H,3-4H2,1-2H3 |
| InChIKey | TXDANBQCVCCEDK-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.27 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|