C17H18BrClO — CID 107955643
(3-bromo-5-chlorophenyl)-(2,5-diethylphenyl)methanol (PubChem CID 107955643) has the molecular formula C17H18BrClO and a molecular weight of 353.69 g/mol. Its IUPAC name is (3-bromo-5-chlorophenyl)-(2,5-diethylphenyl)methanol.
| Compound Name | (3-bromo-5-chlorophenyl)-(2,5-diethylphenyl)methanol |
|---|---|
| PubChem CID | 107955643 |
| Molecular Formula | C17H18BrClO |
| Molecular Weight | 353.69 g/mol |
| Exact Mass | 352.02 |
| IUPAC Name | (3-bromo-5-chlorophenyl)-(2,5-diethylphenyl)methanol |
| SMILES | CCc1ccc(CC)c(C(O)c2cc(Cl)cc(Br)c2)c1 |
| InChI | InChI=1S/C17H18BrClO/c1-3-11-5-6-12(4-2)16(7-11)17(20)13-8-14(18)10-15(19)9-13/h5-10,17,20H,3-4H2,1-2H3 |
| InChIKey | BKEQWBDPRSCDMJ-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.69 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |