C20H33Cl — CID 82990050
1-(1-chloro-2-propylpentyl)-2,4-di(propan-2-yl)benzene (PubChem CID 82990050) has the molecular formula C20H33Cl and a molecular weight of 308.94 g/mol. Its IUPAC name is 1-(1-chloro-2-propylpentyl)-2,4-di(propan-2-yl)benzene.
| Compound Name | 1-(1-chloro-2-propylpentyl)-2,4-di(propan-2-yl)benzene |
|---|---|
| PubChem CID | 82990050 |
| Molecular Formula | C20H33Cl |
| Molecular Weight | 308.94 g/mol |
| Exact Mass | 308.23 |
| IUPAC Name | 1-(1-chloro-2-propylpentyl)-2,4-di(propan-2-yl)benzene |
| SMILES | CCCC(CCC)C(Cl)c1ccc(C(C)C)cc1C(C)C |
| InChI | InChI=1S/C20H33Cl/c1-7-9-16(10-8-2)20(21)18-12-11-17(14(3)4)13-19(18)15(5)6/h11-16,20H,7-10H2,1-6H3 |
| InChIKey | YOEULZIWOMUHIE-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.94 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|