C18H30O — CID 63427128
1-[2,4-di(propan-2-yl)phenyl]hexan-1-ol (PubChem CID 63427128) has the molecular formula C18H30O and a molecular weight of 262.44 g/mol. Its IUPAC name is 1-[2,4-di(propan-2-yl)phenyl]hexan-1-ol.
| Compound Name | 1-[2,4-di(propan-2-yl)phenyl]hexan-1-ol |
|---|---|
| PubChem CID | 63427128 |
| Molecular Formula | C18H30O |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.23 |
| IUPAC Name | 1-[2,4-di(propan-2-yl)phenyl]hexan-1-ol |
| SMILES | CCCCCC(O)c1ccc(C(C)C)cc1C(C)C |
| InChI | InChI=1S/C18H30O/c1-6-7-8-9-18(19)16-11-10-15(13(2)3)12-17(16)14(4)5/h10-14,18-19H,6-9H2,1-5H3 |
| InChIKey | RWTCTRXNHOIEOT-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|