C20H32O — CID 63492659
1-[2,4-di(propan-2-yl)phenyl]octan-1-one (PubChem CID 63492659) has the molecular formula C20H32O and a molecular weight of 288.48 g/mol. Its IUPAC name is 1-[2,4-di(propan-2-yl)phenyl]octan-1-one.
| Compound Name | 1-[2,4-di(propan-2-yl)phenyl]octan-1-one |
|---|---|
| PubChem CID | 63492659 |
| Molecular Formula | C20H32O |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.25 |
| IUPAC Name | 1-[2,4-di(propan-2-yl)phenyl]octan-1-one |
| SMILES | CCCCCCCC(=O)c1ccc(C(C)C)cc1C(C)C |
| InChI | InChI=1S/C20H32O/c1-6-7-8-9-10-11-20(21)18-13-12-17(15(2)3)14-19(18)16(4)5/h12-16H,6-11H2,1-5H3 |
| InChIKey | LLCIGJWFTQWNHZ-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|