C20H32OP- — CID 141022839
[5-oxo-5-[2,4,6-tri(propan-2-yl)phenyl]pentyl]phosphanide (PubChem CID 141022839) has the molecular formula C20H32OP- and a molecular weight of 319.45 g/mol. Its IUPAC name is [5-oxo-5-[2,4,6-tri(propan-2-yl)phenyl]pentyl]phosphanide.
| Compound Name | [5-oxo-5-[2,4,6-tri(propan-2-yl)phenyl]pentyl]phosphanide |
|---|---|
| PubChem CID | 141022839 |
| Molecular Formula | C20H32OP- |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.22 |
| IUPAC Name | [5-oxo-5-[2,4,6-tri(propan-2-yl)phenyl]pentyl]phosphanide |
| SMILES | CC(C)c1cc(C(C)C)c(C(=O)CCCC[PH-])c(C(C)C)c1 |
| InChI | InChI=1S/C20H32OP/c1-13(2)16-11-17(14(3)4)20(18(12-16)15(5)6)19(21)9-7-8-10-22/h11-15,22H,7-10H2,1-6H3/q-1 |
| InChIKey | WTKCZOJRWUOKRE-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|