4-[2,4,6-tri(propan-2-yl)benzoyl]benzoyl chloride

C23H27ClO2 — CID 15835314

IUPAC4-[2,4,6-tri(propan-2-yl)benzoyl]benzoyl chloride
SMILESCC(C)c1cc(C(C)C)c(C(=O)c2ccc(C(=O)Cl)cc2)c(C(C)C)c1
InChIInChI=1S/C23H27ClO2/c1-13(2)18-11-19(14(3)4)21(20(12-18)15(5)6)22(25)16-7-9-17(10-8-16)23(24)26/h7-15H,1-6H3
InChIKeyPELZGVBENCAHGF-UHFFFAOYSA-N
MW370.92 g/mol
LogP6.67
Rot. Bonds6

About 4-[2,4,6-tri(propan-2-yl)benzoyl]benzoyl chloride

4-[2,4,6-tri(propan-2-yl)benzoyl]benzoyl chloride (PubChem CID 15835314) has the molecular formula C23H27ClO2 and a molecular weight of 370.92 g/mol. Its IUPAC name is 4-[2,4,6-tri(propan-2-yl)benzoyl]benzoyl chloride.

Molecular Properties

Compound Name4-[2,4,6-tri(propan-2-yl)benzoyl]benzoyl chloride
PubChem CID15835314
Molecular FormulaC23H27ClO2
Molecular Weight370.92 g/mol
Exact Mass370.17
IUPAC Name4-[2,4,6-tri(propan-2-yl)benzoyl]benzoyl chloride
SMILESCC(C)c1cc(C(C)C)c(C(=O)c2ccc(C(=O)Cl)cc2)c(C(C)C)c1
InChIInChI=1S/C23H27ClO2/c1-13(2)18-11-19(14(3)4)21(20(12-18)15(5)6)22(25)16-7-9-17(10-8-16)23(24)26/h7-15H,1-6H3
InChIKeyPELZGVBENCAHGF-UHFFFAOYSA-N
XLogP6.67
TPSA34.14 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms26
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500370.92
LogP ≤ 56.67
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 4-[2,4,6-tri(propan-2-yl)benzoyl]benzoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[2,4,6-tri(propan-2-yl)benzoyl]benzoyl chloride?
The IUPAC name of 4-[2,4,6-tri(propan-2-yl)benzoyl]benzoyl chloride (CID 15835314) is 4-[2,4,6-tri(propan-2-yl)benzoyl]benzoyl chloride.
What is the SMILES notation for 4-[2,4,6-tri(propan-2-yl)benzoyl]benzoyl chloride?
The canonical SMILES for 4-[2,4,6-tri(propan-2-yl)benzoyl]benzoyl chloride is CC(C)c1cc(C(C)C)c(C(=O)c2ccc(C(=O)Cl)cc2)c(C(C)C)c1.
What is the InChIKey of 4-[2,4,6-tri(propan-2-yl)benzoyl]benzoyl chloride?
The InChIKey is PELZGVBENCAHGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H27ClO2/c1-13(2)18-11-19(14(3)4)21(20(12-18)15(5)6)22(25)16-7-9-17(10-8-16)23(24)26/h7-15H,1-6H3.
What are the key properties of 4-[2,4,6-tri(propan-2-yl)benzoyl]benzoyl chloride?
4-[2,4,6-tri(propan-2-yl)benzoyl]benzoyl chloride has a molecular weight of 370.92 g/mol, XLogP of 6.67, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2,4,6-tri(propan-2-yl)benzoyl]benzoyl chloride is sourced from PubChem (CID 15835314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).