C19H20Br3ClO — CID 160659655
3-bromo-5-propan-2-ylbenzoyl chloride;1,3-dibromo-5-propan-2-ylbenzene (PubChem CID 160659655) has the molecular formula C19H20Br3ClO and a molecular weight of 539.53 g/mol. Its IUPAC name is 3-bromo-5-propan-2-ylbenzoyl chloride;1,3-dibromo-5-propan-2-ylbenzene.
| Compound Name | 3-bromo-5-propan-2-ylbenzoyl chloride;1,3-dibromo-5-propan-2-ylbenzene |
|---|---|
| PubChem CID | 160659655 |
| Molecular Formula | C19H20Br3ClO |
| Molecular Weight | 539.53 g/mol |
| Exact Mass | 535.88 |
| IUPAC Name | 3-bromo-5-propan-2-ylbenzoyl chloride;1,3-dibromo-5-propan-2-ylbenzene |
| SMILES | CC(C)c1cc(Br)cc(Br)c1.CC(C)c1cc(Br)cc(C(=O)Cl)c1 |
| InChI | InChI=1S/C10H10BrClO.C9H10Br2/c1-6(2)7-3-8(10(12)13)5-9(11)4-7;1-6(2)7-3-8(10)5-9(11)4-7/h3-6H,1-2H3;3-6H,1-2H3 |
| InChIKey | RLMUIPHDLDGALR-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.53 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|