C14H19BrO2 — CID 117481908
3-(3-bromo-5-propan-2-ylphenyl)-3-methylbutanoic acid (PubChem CID 117481908) has the molecular formula C14H19BrO2 and a molecular weight of 299.21 g/mol. Its IUPAC name is 3-(3-bromo-5-propan-2-ylphenyl)-3-methylbutanoic acid.
| Compound Name | 3-(3-bromo-5-propan-2-ylphenyl)-3-methylbutanoic acid |
|---|---|
| PubChem CID | 117481908 |
| Molecular Formula | C14H19BrO2 |
| Molecular Weight | 299.21 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 3-(3-bromo-5-propan-2-ylphenyl)-3-methylbutanoic acid |
| SMILES | CC(C)c1cc(Br)cc(C(C)(C)CC(=O)O)c1 |
| InChI | InChI=1S/C14H19BrO2/c1-9(2)10-5-11(7-12(15)6-10)14(3,4)8-13(16)17/h5-7,9H,8H2,1-4H3,(H,16,17) |
| InChIKey | IOLOIWRLHGQRHH-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.21 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |