C20H34LiOP — CID 174463953
lithium;2-methanidylpropane;phosphanyl-[2,4,6-tri(propan-2-yl)phenyl]methanone (PubChem CID 174463953) has the molecular formula C20H34LiOP and a molecular weight of 328.41 g/mol. Its IUPAC name is lithium;2-methanidylpropane;phosphanyl-[2,4,6-tri(propan-2-yl)phenyl]methanone.
| Compound Name | lithium;2-methanidylpropane;phosphanyl-[2,4,6-tri(propan-2-yl)phenyl]methanone |
|---|---|
| PubChem CID | 174463953 |
| Molecular Formula | C20H34LiOP |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.25 |
| IUPAC Name | lithium;2-methanidylpropane;phosphanyl-[2,4,6-tri(propan-2-yl)phenyl]methanone |
| SMILES | CC(C)c1cc(C(C)C)c(C(=O)P)c(C(C)C)c1.[CH2-]C(C)C.[Li+] |
| InChI | InChI=1S/C16H25OP.C4H9.Li/c1-9(2)12-7-13(10(3)4)15(16(17)18)14(8-12)11(5)6;1-4(2)3;/h7-11H,18H2,1-6H3;4H,1H2,2-3H3;/q;-1;+1 |
| InChIKey | DNDFQLUSWCRFSQ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|