C25H32O2S — CID 12820140
S-(3-hydroxy-3-phenylprop-1-en-2-yl) 2,4,6-tri(propan-2-yl)benzenecarbothioate (PubChem CID 12820140) has the molecular formula C25H32O2S and a molecular weight of 396.60 g/mol. Its IUPAC name is S-(3-hydroxy-3-phenylprop-1-en-2-yl) 2,4,6-tri(propan-2-yl)benzenecarbothioate.
| Compound Name | S-(3-hydroxy-3-phenylprop-1-en-2-yl) 2,4,6-tri(propan-2-yl)benzenecarbothioate |
|---|---|
| PubChem CID | 12820140 |
| Molecular Formula | C25H32O2S |
| Molecular Weight | 396.60 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | S-(3-hydroxy-3-phenylprop-1-en-2-yl) 2,4,6-tri(propan-2-yl)benzenecarbothioate |
| SMILES | C=C(SC(=O)c1c(C(C)C)cc(C(C)C)cc1C(C)C)C(O)c1ccccc1 |
| InChI | InChI=1S/C25H32O2S/c1-15(2)20-13-21(16(3)4)23(22(14-20)17(5)6)25(27)28-18(7)24(26)19-11-9-8-10-12-19/h8-17,24,26H,7H2,1-6H3 |
| InChIKey | IGUDPMUDGMQKKL-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.60 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|