C13H19NO5 — CID 67781255
(2S)-2-amino-3-methylbutanoic acid;2-hydroxy-2-phenylacetic acid (PubChem CID 67781255) has the molecular formula C13H19NO5 and a molecular weight of 269.30 g/mol. Its IUPAC name is (2S)-2-amino-3-methylbutanoic acid;2-hydroxy-2-phenylacetic acid.
| Compound Name | (2S)-2-amino-3-methylbutanoic acid;2-hydroxy-2-phenylacetic acid |
|---|---|
| PubChem CID | 67781255 |
| Molecular Formula | C13H19NO5 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | (2S)-2-amino-3-methylbutanoic acid;2-hydroxy-2-phenylacetic acid |
| SMILES | CC(C)[C@H](N)C(=O)O.O=C(O)C(O)c1ccccc1 |
| InChI | InChI=1S/C8H8O3.C5H11NO2/c9-7(8(10)11)6-4-2-1-3-5-6;1-3(2)4(6)5(7)8/h1-5,7,9H,(H,10,11);3-4H,6H2,1-2H3,(H,7,8)/t;4-/m.0/s1 |
| InChIKey | ZMVHDWGKZMSHDJ-VWMHFEHESA-N |
| XLogP | 0.86 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |