C24H32O3 — CID 25271023
(2-hydroxy-2-phenylethyl) 2,4,6-tri(propan-2-yl)benzoate (PubChem CID 25271023) has the molecular formula C24H32O3 and a molecular weight of 368.52 g/mol. Its IUPAC name is (2-hydroxy-2-phenylethyl) 2,4,6-tri(propan-2-yl)benzoate.
| Compound Name | (2-hydroxy-2-phenylethyl) 2,4,6-tri(propan-2-yl)benzoate |
|---|---|
| PubChem CID | 25271023 |
| Molecular Formula | C24H32O3 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.24 |
| IUPAC Name | (2-hydroxy-2-phenylethyl) 2,4,6-tri(propan-2-yl)benzoate |
| SMILES | CC(C)c1cc(C(C)C)c(C(=O)OCC(O)c2ccccc2)c(C(C)C)c1 |
| InChI | InChI=1S/C24H32O3/c1-15(2)19-12-20(16(3)4)23(21(13-19)17(5)6)24(26)27-14-22(25)18-10-8-7-9-11-18/h7-13,15-17,22,25H,14H2,1-6H3 |
| InChIKey | HDJKVLYQRWBHRD-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |