About (2-hydroxy-2-phenylethyl) hypochlorite;scandium
(2-hydroxy-2-phenylethyl) hypochlorite;scandium (PubChem CID 155773445) has the molecular formula C8H9ClO2Sc
and a molecular weight of 217.57 g/mol. Its IUPAC name is (2-hydroxy-2-phenylethyl) hypochlorite;scandium.
Molecular Properties
| Compound Name | (2-hydroxy-2-phenylethyl) hypochlorite;scandium |
| PubChem CID | 155773445 |
| Molecular Formula | C8H9ClO2Sc |
| Molecular Weight | 217.57 g/mol |
| Exact Mass | 216.99 |
| IUPAC Name | (2-hydroxy-2-phenylethyl) hypochlorite;scandium |
| SMILES | OC(COCl)c1ccccc1.[Sc] |
| InChI | InChI=1S/C8H9ClO2.Sc/c9-11-6-8(10)7-4-2-1-3-5-7;/h1-5,8,10H,6H2; |
| InChIKey | GFGRLPVFNIIBQY-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.57 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2-hydroxy-2-phenylethyl) hypochlorite;scandium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-hydroxy-2-phenylethyl) hypochlorite;scandium?
The IUPAC name of (2-hydroxy-2-phenylethyl) hypochlorite;scandium (CID 155773445) is (2-hydroxy-2-phenylethyl) hypochlorite;scandium.
What is the SMILES notation for (2-hydroxy-2-phenylethyl) hypochlorite;scandium?
The canonical SMILES for (2-hydroxy-2-phenylethyl) hypochlorite;scandium is OC(COCl)c1ccccc1.[Sc].
What is the InChIKey of (2-hydroxy-2-phenylethyl) hypochlorite;scandium?
The InChIKey is GFGRLPVFNIIBQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9ClO2.Sc/c9-11-6-8(10)7-4-2-1-3-5-7;/h1-5,8,10H,6H2;.
What are the key properties of (2-hydroxy-2-phenylethyl) hypochlorite;scandium?
(2-hydroxy-2-phenylethyl) hypochlorite;scandium has a molecular weight of 217.57 g/mol, XLogP of 1.89, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-hydroxy-2-phenylethyl) hypochlorite;scandium is sourced from PubChem (CID 155773445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).