C10H11F3O2 — CID 162372103
(1S)-1-phenyl-2-(2,2,2-trifluoroethoxy)ethanol (PubChem CID 162372103) has the molecular formula C10H11F3O2 and a molecular weight of 220.19 g/mol. Its IUPAC name is (1S)-1-phenyl-2-(2,2,2-trifluoroethoxy)ethanol.
| Compound Name | (1S)-1-phenyl-2-(2,2,2-trifluoroethoxy)ethanol |
|---|---|
| PubChem CID | 162372103 |
| Molecular Formula | C10H11F3O2 |
| Molecular Weight | 220.19 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | (1S)-1-phenyl-2-(2,2,2-trifluoroethoxy)ethanol |
| SMILES | O[C@H](COCC(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C10H11F3O2/c11-10(12,13)7-15-6-9(14)8-4-2-1-3-5-8/h1-5,9,14H,6-7H2/t9-/m1/s1 |
| InChIKey | IFFZLRAHNTWDDZ-SECBINFHSA-N |
| XLogP | 2.30 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.19 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |