C8H11F3N2O2 — CID 103216659
1-(1-methylpyrazol-4-yl)-2-(2,2,2-trifluoroethoxy)ethanol (PubChem CID 103216659) has the molecular formula C8H11F3N2O2 and a molecular weight of 224.18 g/mol. Its IUPAC name is 1-(1-methylpyrazol-4-yl)-2-(2,2,2-trifluoroethoxy)ethanol.
| Compound Name | 1-(1-methylpyrazol-4-yl)-2-(2,2,2-trifluoroethoxy)ethanol |
|---|---|
| PubChem CID | 103216659 |
| Molecular Formula | C8H11F3N2O2 |
| Molecular Weight | 224.18 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | 1-(1-methylpyrazol-4-yl)-2-(2,2,2-trifluoroethoxy)ethanol |
| SMILES | Cn1cc(C(O)COCC(F)(F)F)cn1 |
| InChI | InChI=1S/C8H11F3N2O2/c1-13-3-6(2-12-13)7(14)4-15-5-8(9,10)11/h2-3,7,14H,4-5H2,1H3 |
| InChIKey | BSLRWZBGTFYTNU-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.18 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |