C10H11F3O2S — CID 123889805
1-(4-sulfanylphenyl)-2-(2,2,2-trifluoroethoxy)ethanol (PubChem CID 123889805) has the molecular formula C10H11F3O2S and a molecular weight of 252.26 g/mol. Its IUPAC name is 1-(4-sulfanylphenyl)-2-(2,2,2-trifluoroethoxy)ethanol.
| Compound Name | 1-(4-sulfanylphenyl)-2-(2,2,2-trifluoroethoxy)ethanol |
|---|---|
| PubChem CID | 123889805 |
| Molecular Formula | C10H11F3O2S |
| Molecular Weight | 252.26 g/mol |
| Exact Mass | 252.04 |
| IUPAC Name | 1-(4-sulfanylphenyl)-2-(2,2,2-trifluoroethoxy)ethanol |
| SMILES | OC(COCC(F)(F)F)c1ccc(S)cc1 |
| InChI | InChI=1S/C10H11F3O2S/c11-10(12,13)6-15-5-9(14)7-1-3-8(16)4-2-7/h1-4,9,14,16H,5-6H2 |
| InChIKey | OYPMUVWKUYVEOG-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.26 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|