C13H17F3O5 — CID 103210091
2-(2,2,2-trifluoroethoxy)-1-(2,4,6-trimethoxyphenyl)ethanol (PubChem CID 103210091) has the molecular formula C13H17F3O5 and a molecular weight of 310.27 g/mol. Its IUPAC name is 2-(2,2,2-trifluoroethoxy)-1-(2,4,6-trimethoxyphenyl)ethanol.
| Compound Name | 2-(2,2,2-trifluoroethoxy)-1-(2,4,6-trimethoxyphenyl)ethanol |
|---|---|
| PubChem CID | 103210091 |
| Molecular Formula | C13H17F3O5 |
| Molecular Weight | 310.27 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 2-(2,2,2-trifluoroethoxy)-1-(2,4,6-trimethoxyphenyl)ethanol |
| SMILES | COc1cc(OC)c(C(O)COCC(F)(F)F)c(OC)c1 |
| InChI | InChI=1S/C13H17F3O5/c1-18-8-4-10(19-2)12(11(5-8)20-3)9(17)6-21-7-13(14,15)16/h4-5,9,17H,6-7H2,1-3H3 |
| InChIKey | YHBHGFFDNIPQLO-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.27 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |