C12H15F3O4 — CID 166218971
1-(3,5-dimethoxyphenoxy)-4,4,4-trifluorobutan-2-ol (PubChem CID 166218971) has the molecular formula C12H15F3O4 and a molecular weight of 280.24 g/mol. Its IUPAC name is 1-(3,5-dimethoxyphenoxy)-4,4,4-trifluorobutan-2-ol.
| Compound Name | 1-(3,5-dimethoxyphenoxy)-4,4,4-trifluorobutan-2-ol |
|---|---|
| PubChem CID | 166218971 |
| Molecular Formula | C12H15F3O4 |
| Molecular Weight | 280.24 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 1-(3,5-dimethoxyphenoxy)-4,4,4-trifluorobutan-2-ol |
| SMILES | COc1cc(OC)cc(OCC(O)CC(F)(F)F)c1 |
| InChI | InChI=1S/C12H15F3O4/c1-17-9-3-10(18-2)5-11(4-9)19-7-8(16)6-12(13,14)15/h3-5,8,16H,6-7H2,1-2H3 |
| InChIKey | XNZXENUXGCNYKF-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.24 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |