C12H19ClN2O5 — CID 157229770
4-(3,5-dimethoxyphenoxy)-N',3-dihydroxybutanimidamide;hydrochloride (PubChem CID 157229770) has the molecular formula C12H19ClN2O5 and a molecular weight of 306.75 g/mol. Its IUPAC name is 4-(3,5-dimethoxyphenoxy)-N',3-dihydroxybutanimidamide;hydrochloride.
| Compound Name | 4-(3,5-dimethoxyphenoxy)-N',3-dihydroxybutanimidamide;hydrochloride |
|---|---|
| PubChem CID | 157229770 |
| Molecular Formula | C12H19ClN2O5 |
| Molecular Weight | 306.75 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 4-(3,5-dimethoxyphenoxy)-N',3-dihydroxybutanimidamide;hydrochloride |
| SMILES | COc1cc(OC)cc(OCC(O)CC(N)=NO)c1.Cl |
| InChI | InChI=1S/C12H18N2O5.ClH/c1-17-9-4-10(18-2)6-11(5-9)19-7-8(15)3-12(13)14-16;/h4-6,8,15-16H,3,7H2,1-2H3,(H2,13,14);1H |
| InChIKey | ATYRXZFVZQSCNR-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 106.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.75 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|