C10H10ClF3O2 — CID 167854837
1-(3-chlorophenoxy)-4,4,4-trifluorobutan-2-ol (PubChem CID 167854837) has the molecular formula C10H10ClF3O2 and a molecular weight of 254.63 g/mol. Its IUPAC name is 1-(3-chlorophenoxy)-4,4,4-trifluorobutan-2-ol.
| Compound Name | 1-(3-chlorophenoxy)-4,4,4-trifluorobutan-2-ol |
|---|---|
| PubChem CID | 167854837 |
| Molecular Formula | C10H10ClF3O2 |
| Molecular Weight | 254.63 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | 1-(3-chlorophenoxy)-4,4,4-trifluorobutan-2-ol |
| SMILES | OC(COc1cccc(Cl)c1)CC(F)(F)F |
| InChI | InChI=1S/C10H10ClF3O2/c11-7-2-1-3-9(4-7)16-6-8(15)5-10(12,13)14/h1-4,8,15H,5-6H2 |
| InChIKey | YNTASFYXYCPSSP-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.63 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |