C13H12F3NO2S — CID 125140266
(2S)-4,4,4-trifluoro-1-[3-(1,3-thiazol-2-yl)phenoxy]butan-2-ol (PubChem CID 125140266) has the molecular formula C13H12F3NO2S and a molecular weight of 303.31 g/mol. Its IUPAC name is (2S)-4,4,4-trifluoro-1-[3-(1,3-thiazol-2-yl)phenoxy]butan-2-ol.
| Compound Name | (2S)-4,4,4-trifluoro-1-[3-(1,3-thiazol-2-yl)phenoxy]butan-2-ol |
|---|---|
| PubChem CID | 125140266 |
| Molecular Formula | C13H12F3NO2S |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | (2S)-4,4,4-trifluoro-1-[3-(1,3-thiazol-2-yl)phenoxy]butan-2-ol |
| SMILES | O[C@H](COc1cccc(-c2nccs2)c1)CC(F)(F)F |
| InChI | InChI=1S/C13H12F3NO2S/c14-13(15,16)7-10(18)8-19-11-3-1-2-9(6-11)12-17-4-5-20-12/h1-6,10,18H,7-8H2/t10-/m0/s1 |
| InChIKey | FWSLXWZICLCGML-JTQLQIEISA-N |
| XLogP | 3.50 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |