C14H14F3NO2S — CID 119039533
4,4,4-trifluoro-1-[4-(2-methyl-1,3-thiazol-4-yl)phenoxy]butan-2-ol (PubChem CID 119039533) has the molecular formula C14H14F3NO2S and a molecular weight of 317.33 g/mol. Its IUPAC name is 4,4,4-trifluoro-1-[4-(2-methyl-1,3-thiazol-4-yl)phenoxy]butan-2-ol.
| Compound Name | 4,4,4-trifluoro-1-[4-(2-methyl-1,3-thiazol-4-yl)phenoxy]butan-2-ol |
|---|---|
| PubChem CID | 119039533 |
| Molecular Formula | C14H14F3NO2S |
| Molecular Weight | 317.33 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | 4,4,4-trifluoro-1-[4-(2-methyl-1,3-thiazol-4-yl)phenoxy]butan-2-ol |
| SMILES | Cc1nc(-c2ccc(OCC(O)CC(F)(F)F)cc2)cs1 |
| InChI | InChI=1S/C14H14F3NO2S/c1-9-18-13(8-21-9)10-2-4-12(5-3-10)20-7-11(19)6-14(15,16)17/h2-5,8,11,19H,6-7H2,1H3 |
| InChIKey | FOUXDFXYUUCOFH-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.33 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |