C19H25F3N4O2S — CID 109424888
3-ethyl-2-[2-hydroxy-3-[4-(trifluoromethyl)phenoxy]propyl]-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine (PubChem CID 109424888) has the molecular formula C19H25F3N4O2S and a molecular weight of 430.50 g/mol. Its IUPAC name is 3-ethyl-2-[2-hydroxy-3-[4-(trifluoromethyl)phenoxy]propyl]-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine.
| Compound Name | 3-ethyl-2-[2-hydroxy-3-[4-(trifluoromethyl)phenoxy]propyl]-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 109424888 |
| Molecular Formula | C19H25F3N4O2S |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | 3-ethyl-2-[2-hydroxy-3-[4-(trifluoromethyl)phenoxy]propyl]-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine |
| SMILES | CCN/C(=N\CC(O)COc1ccc(C(F)(F)F)cc1)N(C)Cc1csc(C)n1 |
| InChI | InChI=1S/C19H25F3N4O2S/c1-4-23-18(26(3)10-15-12-29-13(2)25-15)24-9-16(27)11-28-17-7-5-14(6-8-17)19(20,21)22/h5-8,12,16,27H,4,9-11H2,1-3H3,(H,23,24) |
| InChIKey | SDAVGXRANCNMJX-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 69.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|