C15H20F3N5S2 — CID 109421802
3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine (PubChem CID 109421802) has the molecular formula C15H20F3N5S2 and a molecular weight of 391.49 g/mol. Its IUPAC name is 3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine.
| Compound Name | 3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine |
|---|---|
| PubChem CID | 109421802 |
| Molecular Formula | C15H20F3N5S2 |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | 3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine |
| SMILES | CCN/C(=N\CCc1nc(C(F)(F)F)cs1)N(C)Cc1csc(C)n1 |
| InChI | InChI=1S/C15H20F3N5S2/c1-4-19-14(23(3)7-11-8-24-10(2)21-11)20-6-5-13-22-12(9-25-13)15(16,17)18/h8-9H,4-7H2,1-3H3,(H,19,20) |
| InChIKey | QIANADZEHYDYFE-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 53.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|