About 4-[4-[2-(4,4-difluoropiperidin-1-yl)ethoxy]phenyl]-2-methyl-1,3-thiazole
4-[4-[2-(4,4-difluoropiperidin-1-yl)ethoxy]phenyl]-2-methyl-1,3-thiazole (PubChem CID 123280035) has the molecular formula C17H20F2N2OS
and a molecular weight of 338.42 g/mol. Its IUPAC name is 4-[4-[2-(4,4-difluoropiperidin-1-yl)ethoxy]phenyl]-2-methyl-1,3-thiazole.
Molecular Properties
| Compound Name | 4-[4-[2-(4,4-difluoropiperidin-1-yl)ethoxy]phenyl]-2-methyl-1,3-thiazole |
| PubChem CID | 123280035 |
| Molecular Formula | C17H20F2N2OS |
| Molecular Weight | 338.42 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 4-[4-[2-(4,4-difluoropiperidin-1-yl)ethoxy]phenyl]-2-methyl-1,3-thiazole |
| SMILES | Cc1nc(-c2ccc(OCCN3CCC(F)(F)CC3)cc2)cs1 |
| InChI | InChI=1S/C17H20F2N2OS/c1-13-20-16(12-23-13)14-2-4-15(5-3-14)22-11-10-21-8-6-17(18,19)7-9-21/h2-5,12H,6-11H2,1H3 |
| InChIKey | BKBDJRZGHDLCBF-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.42 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[4-[2-(4,4-difluoropiperidin-1-yl)ethoxy]phenyl]-2-methyl-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-[2-(4,4-difluoropiperidin-1-yl)ethoxy]phenyl]-2-methyl-1,3-thiazole?
The IUPAC name of 4-[4-[2-(4,4-difluoropiperidin-1-yl)ethoxy]phenyl]-2-methyl-1,3-thiazole (CID 123280035) is 4-[4-[2-(4,4-difluoropiperidin-1-yl)ethoxy]phenyl]-2-methyl-1,3-thiazole.
What is the SMILES notation for 4-[4-[2-(4,4-difluoropiperidin-1-yl)ethoxy]phenyl]-2-methyl-1,3-thiazole?
The canonical SMILES for 4-[4-[2-(4,4-difluoropiperidin-1-yl)ethoxy]phenyl]-2-methyl-1,3-thiazole is Cc1nc(-c2ccc(OCCN3CCC(F)(F)CC3)cc2)cs1.
What is the InChIKey of 4-[4-[2-(4,4-difluoropiperidin-1-yl)ethoxy]phenyl]-2-methyl-1,3-thiazole?
The InChIKey is BKBDJRZGHDLCBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20F2N2OS/c1-13-20-16(12-23-13)14-2-4-15(5-3-14)22-11-10-21-8-6-17(18,19)7-9-21/h2-5,12H,6-11H2,1H3.
What are the key properties of 4-[4-[2-(4,4-difluoropiperidin-1-yl)ethoxy]phenyl]-2-methyl-1,3-thiazole?
4-[4-[2-(4,4-difluoropiperidin-1-yl)ethoxy]phenyl]-2-methyl-1,3-thiazole has a molecular weight of 338.42 g/mol, XLogP of 4.23, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[2-(4,4-difluoropiperidin-1-yl)ethoxy]phenyl]-2-methyl-1,3-thiazole is sourced from PubChem (CID 123280035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).