C15H16F2N2S — CID 77095750
2-[(4,4-difluoropiperidin-1-yl)methyl]-4-phenyl-1,3-thiazole (PubChem CID 77095750) has the molecular formula C15H16F2N2S and a molecular weight of 294.37 g/mol. Its IUPAC name is 2-[(4,4-difluoropiperidin-1-yl)methyl]-4-phenyl-1,3-thiazole.
| Compound Name | 2-[(4,4-difluoropiperidin-1-yl)methyl]-4-phenyl-1,3-thiazole |
|---|---|
| PubChem CID | 77095750 |
| Molecular Formula | C15H16F2N2S |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 2-[(4,4-difluoropiperidin-1-yl)methyl]-4-phenyl-1,3-thiazole |
| SMILES | FC1(F)CCN(Cc2nc(-c3ccccc3)cs2)CC1 |
| InChI | InChI=1S/C15H16F2N2S/c16-15(17)6-8-19(9-7-15)10-14-18-13(11-20-14)12-4-2-1-3-5-12/h1-5,11H,6-10H2 |
| InChIKey | IHGXHSWCKWYPSZ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |