C13H12ClF3N2O2 — CID 12878473
1-chloro-3-[3-[5-(trifluoromethyl)-1H-imidazol-2-yl]phenoxy]propan-2-ol (PubChem CID 12878473) has the molecular formula C13H12ClF3N2O2 and a molecular weight of 320.70 g/mol. Its IUPAC name is 1-chloro-3-[3-[5-(trifluoromethyl)-1H-imidazol-2-yl]phenoxy]propan-2-ol.
| Compound Name | 1-chloro-3-[3-[5-(trifluoromethyl)-1H-imidazol-2-yl]phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 12878473 |
| Molecular Formula | C13H12ClF3N2O2 |
| Molecular Weight | 320.70 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | 1-chloro-3-[3-[5-(trifluoromethyl)-1H-imidazol-2-yl]phenoxy]propan-2-ol |
| SMILES | OC(CCl)COc1cccc(-c2ncc(C(F)(F)F)[nH]2)c1 |
| InChI | InChI=1S/C13H12ClF3N2O2/c14-5-9(20)7-21-10-3-1-2-8(4-10)12-18-6-11(19-12)13(15,16)17/h1-4,6,9,20H,5,7H2,(H,18,19) |
| InChIKey | PIJDBSOAKSANAK-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 58.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.70 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|