C11H8ClF3N2 — CID 170707449
2-[4-(chloromethyl)phenyl]-5-(trifluoromethyl)-1H-imidazole (PubChem CID 170707449) has the molecular formula C11H8ClF3N2 and a molecular weight of 260.65 g/mol. Its IUPAC name is 2-[4-(chloromethyl)phenyl]-5-(trifluoromethyl)-1H-imidazole.
| Compound Name | 2-[4-(chloromethyl)phenyl]-5-(trifluoromethyl)-1H-imidazole |
|---|---|
| PubChem CID | 170707449 |
| Molecular Formula | C11H8ClF3N2 |
| Molecular Weight | 260.65 g/mol |
| Exact Mass | 260.03 |
| IUPAC Name | 2-[4-(chloromethyl)phenyl]-5-(trifluoromethyl)-1H-imidazole |
| SMILES | FC(F)(F)c1cnc(-c2ccc(CCl)cc2)[nH]1 |
| InChI | InChI=1S/C11H8ClF3N2/c12-5-7-1-3-8(4-2-7)10-16-6-9(17-10)11(13,14)15/h1-4,6H,5H2,(H,16,17) |
| InChIKey | WVEKJCZFCZULAG-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.65 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|