C11H6F6N2O — CID 151930953
2-[4-(trifluoromethoxy)phenyl]-5-(trifluoromethyl)-1H-imidazole (PubChem CID 151930953) has the molecular formula C11H6F6N2O and a molecular weight of 296.17 g/mol. Its IUPAC name is 2-[4-(trifluoromethoxy)phenyl]-5-(trifluoromethyl)-1H-imidazole.
| Compound Name | 2-[4-(trifluoromethoxy)phenyl]-5-(trifluoromethyl)-1H-imidazole |
|---|---|
| PubChem CID | 151930953 |
| Molecular Formula | C11H6F6N2O |
| Molecular Weight | 296.17 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | 2-[4-(trifluoromethoxy)phenyl]-5-(trifluoromethyl)-1H-imidazole |
| SMILES | FC(F)(F)Oc1ccc(-c2ncc(C(F)(F)F)[nH]2)cc1 |
| InChI | InChI=1S/C11H6F6N2O/c12-10(13,14)8-5-18-9(19-8)6-1-3-7(4-2-6)20-11(15,16)17/h1-5H,(H,18,19) |
| InChIKey | SYTVVZXEFNLTNO-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.17 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |