C11H15BrO3 — CID 116863258
2-bromo-1-(2,4-dimethoxy-6-methylphenyl)ethanol (PubChem CID 116863258) has the molecular formula C11H15BrO3 and a molecular weight of 275.14 g/mol. Its IUPAC name is 2-bromo-1-(2,4-dimethoxy-6-methylphenyl)ethanol.
| Compound Name | 2-bromo-1-(2,4-dimethoxy-6-methylphenyl)ethanol |
|---|---|
| PubChem CID | 116863258 |
| Molecular Formula | C11H15BrO3 |
| Molecular Weight | 275.14 g/mol |
| Exact Mass | 274.02 |
| IUPAC Name | 2-bromo-1-(2,4-dimethoxy-6-methylphenyl)ethanol |
| SMILES | COc1cc(C)c(C(O)CBr)c(OC)c1 |
| InChI | InChI=1S/C11H15BrO3/c1-7-4-8(14-2)5-10(15-3)11(7)9(13)6-12/h4-5,9,13H,6H2,1-3H3 |
| InChIKey | GCZJVBXFUULUJR-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.14 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|