C11H16BrNO2 — CID 116961980
1-bromo-1-(2,4-dimethoxy-6-methylphenyl)-N-methylmethanamine (PubChem CID 116961980) has the molecular formula C11H16BrNO2 and a molecular weight of 274.16 g/mol. Its IUPAC name is 1-bromo-1-(2,4-dimethoxy-6-methylphenyl)-N-methylmethanamine.
| Compound Name | 1-bromo-1-(2,4-dimethoxy-6-methylphenyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 116961980 |
| Molecular Formula | C11H16BrNO2 |
| Molecular Weight | 274.16 g/mol |
| Exact Mass | 273.04 |
| IUPAC Name | 1-bromo-1-(2,4-dimethoxy-6-methylphenyl)-N-methylmethanamine |
| SMILES | CNC(Br)c1c(C)cc(OC)cc1OC |
| InChI | InChI=1S/C11H16BrNO2/c1-7-5-8(14-3)6-9(15-4)10(7)11(12)13-2/h5-6,11,13H,1-4H3 |
| InChIKey | UCLKTOWVTVJNKP-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.16 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|