C11H17NO3S — CID 116954536
methylamino-(2,4,6-trimethoxyphenyl)methanethiol (PubChem CID 116954536) has the molecular formula C11H17NO3S and a molecular weight of 243.33 g/mol. Its IUPAC name is methylamino-(2,4,6-trimethoxyphenyl)methanethiol.
| Compound Name | methylamino-(2,4,6-trimethoxyphenyl)methanethiol |
|---|---|
| PubChem CID | 116954536 |
| Molecular Formula | C11H17NO3S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | methylamino-(2,4,6-trimethoxyphenyl)methanethiol |
| SMILES | CNC(S)c1c(OC)cc(OC)cc1OC |
| InChI | InChI=1S/C11H17NO3S/c1-12-11(16)10-8(14-3)5-7(13-2)6-9(10)15-4/h5-6,11-12,16H,1-4H3 |
| InChIKey | YVAZBWCMSUSEJE-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|