C12H15F3O4 — CID 106705176
1-[4-methoxy-2-(2,2,2-trifluoroethoxymethoxy)phenyl]ethanol (PubChem CID 106705176) has the molecular formula C12H15F3O4 and a molecular weight of 280.24 g/mol. Its IUPAC name is 1-[4-methoxy-2-(2,2,2-trifluoroethoxymethoxy)phenyl]ethanol.
| Compound Name | 1-[4-methoxy-2-(2,2,2-trifluoroethoxymethoxy)phenyl]ethanol |
|---|---|
| PubChem CID | 106705176 |
| Molecular Formula | C12H15F3O4 |
| Molecular Weight | 280.24 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 1-[4-methoxy-2-(2,2,2-trifluoroethoxymethoxy)phenyl]ethanol |
| SMILES | COc1ccc(C(C)O)c(OCOCC(F)(F)F)c1 |
| InChI | InChI=1S/C12H15F3O4/c1-8(16)10-4-3-9(17-2)5-11(10)19-7-18-6-12(13,14)15/h3-5,8,16H,6-7H2,1-2H3 |
| InChIKey | IKCFZRJGBKHTGH-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.24 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|